cas: 1305320-69-7 — see every product listed under this CAS number, including other names
1-Boc-3-(1-phenylethylamino)-4-piperidinemethanol, >95%, >95% (CAS 1305320-69-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111UKY-100mg |
| cas | 1305320-69-7 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 486.80 Pln | |
| Chemat | 1g | 1442.00 Pln | |
| Chemat | 5g | 3386.00 Pln |
| purity | >95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(hydroxymethyl)-3-(1-phenylethylamino)piperidine-1-carboxylate (CAS 1305320-69-7) is a chemical compound with the molecular formula C19H30N2O3 and a molecular weight of 334.5 g/mol. IUPAC name: tert-butyl 4-(hydroxymethyl)-3-(1-phenylethylamino)piperidine-1-carboxylate. InChIKey: HGOOISFRTZCVFQ-UHFFFAOYSA-N.
| Molecular formula | C19H30N2O3 |
|---|---|
| Molecular weight | 334.5 g/mol |
| IUPAC name | tert-butyl 4-(hydroxymethyl)-3-(1-phenylethylamino)piperidine-1-carboxylate |
| InChIKey | HGOOISFRTZCVFQ-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=CC=C1)NC2CN(CCC2CO)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)