cas: 775305-12-9 — see every product listed under this CAS number, including other names
1-Boc-3-Bromo-2-methylindole, 97% (CAS 775305-12-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F225012-1G |
| cas | 775305-12-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 138.51 Pln | |
| Fluorochem | 5g | 388.42 Pln | |
| Fluorochem | 10g | 726.85 Pln | |
| Fluorochem | 25g | 1205.84 Pln | |
| Fluorochem | 100g | 4668.17 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-bromo-2-methylindole-1-carboxylate (CAS 775305-12-9) is a chemical compound with the molecular formula C14H16BrNO2 and a molecular weight of 310.19 g/mol. IUPAC name: tert-butyl 3-bromo-2-methylindole-1-carboxylate. InChIKey: RUAYZSFSPSZYHI-UHFFFAOYSA-N.
| Molecular formula | C14H16BrNO2 |
|---|---|
| Molecular weight | 310.19 g/mol |
| IUPAC name | tert-butyl 3-bromo-2-methylindole-1-carboxylate |
| InChIKey | RUAYZSFSPSZYHI-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1C(=O)OC(C)(C)C)Br |
Computed by PubChem (NCBI)