cas: 276872-89-0 — see every product listed under this CAS number, including other names
1-Boc-3-Methylene-piperidine, 97% (CAS 276872-89-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F048646-1G |
| cas | 276872-89-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 320.74 Pln | |
| Fluorochem | 10g | 575.86 Pln | |
| Fluorochem | 25g | 924.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl 3-methylidenepiperidine-1-carboxylate (CAS 276872-89-0) is a chemical compound with the molecular formula C11H19NO2 and a molecular weight of 197.27 g/mol. IUPAC name: tert-butyl 3-methylidenepiperidine-1-carboxylate. InChIKey: CENNZHRFKNCIBU-UHFFFAOYSA-N.
| Molecular formula | C11H19NO2 |
|---|---|
| Molecular weight | 197.27 g/mol |
| IUPAC name | tert-butyl 3-methylidenepiperidine-1-carboxylate |
| InChIKey | CENNZHRFKNCIBU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(=C)C1 |
Computed by PubChem (NCBI)