cas: 165528-85-8 — see every product listed under this CAS number, including other names
1-Boc-4-(3-oxopropyl)piperidine, 95%, 95% (CAS 165528-85-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112W81-100mg |
| cas | 165528-85-8 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 347.60 Pln | |
| Chemat | 250mg | 650.00 Pln | |
| Chemat | 1g | 1384.40 Pln | |
| Chemat | 5g | 5334.80 Pln | |
| Chemat | 10g | 8502.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(3-oxopropyl)piperidine-1-carboxylate (CAS 165528-85-8) is a chemical compound with the molecular formula C13H23NO3 and a molecular weight of 241.33 g/mol. IUPAC name: tert-butyl 4-(3-oxopropyl)piperidine-1-carboxylate. InChIKey: KJGPCTZYGOOHBK-UHFFFAOYSA-N.
| Molecular formula | C13H23NO3 |
|---|---|
| Molecular weight | 241.33 g/mol |
| IUPAC name | tert-butyl 4-(3-oxopropyl)piperidine-1-carboxylate |
| InChIKey | KJGPCTZYGOOHBK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCC=O |
Computed by PubChem (NCBI)