cas: 142355-81-5 — see every product listed under this CAS number, including other names
1-Boc-4-(4-Bromo-butyl)-piperidine, 97% (CAS 142355-81-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 500mg, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041251-1G |
| cas | 142355-81-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 2642.84 Pln | |
| Fluorochem | 500mg | 1788.97 Pln | |
| Fluorochem | 5g | 8000.33 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(4-bromobutyl)piperidine-1-carboxylate (CAS 142355-81-5) is a chemical compound with the molecular formula C14H26BrNO2 and a molecular weight of 320.27 g/mol. IUPAC name: tert-butyl 4-(4-bromobutyl)piperidine-1-carboxylate. InChIKey: VRSNDRCACPSZIP-UHFFFAOYSA-N.
| Molecular formula | C14H26BrNO2 |
|---|---|
| Molecular weight | 320.27 g/mol |
| IUPAC name | tert-butyl 4-(4-bromobutyl)piperidine-1-carboxylate |
| InChIKey | VRSNDRCACPSZIP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)CCCCBr |
Computed by PubChem (NCBI)