cas: 163209-96-9 — see every product listed under this CAS number, including other names
1-Boc-4-(4-Bromo-phenyl)-piperidin-4-ol, 97% (CAS 163209-96-9) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041321-500MG |
| cas | 163209-96-9 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 1247.50 Pln | |
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 5g | 5355.42 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4-(4-bromophenyl)-4-hydroxypiperidine-1-carboxylate (CAS 163209-96-9) is a chemical compound with the molecular formula C16H22BrNO3 and a molecular weight of 356.25 g/mol. IUPAC name: tert-butyl 4-(4-bromophenyl)-4-hydroxypiperidine-1-carboxylate. InChIKey: ZXVYIHCSSJUVBB-UHFFFAOYSA-N.
| Molecular formula | C16H22BrNO3 |
|---|---|
| Molecular weight | 356.25 g/mol |
| IUPAC name | tert-butyl 4-(4-bromophenyl)-4-hydroxypiperidine-1-carboxylate |
| InChIKey | ZXVYIHCSSJUVBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)(C2=CC=C(C=C2)Br)O |
Computed by PubChem (NCBI)