cas: 170011-56-0 — see every product listed under this CAS number, including other names
1-Boc-4-(4-nitrophenyl)piperidine, 95%, 95% (CAS 170011-56-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ARUX-250mg |
| cas | 170011-56-0 |
| size | 250mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 299.60 Pln | |
| Chemat | 5g | 899.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 4-(4-nitrophenyl)piperidine-1-carboxylate (CAS 170011-56-0) is a chemical compound with the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. IUPAC name: tert-butyl 4-(4-nitrophenyl)piperidine-1-carboxylate. InChIKey: HNXBHNXMRSXDRQ-UHFFFAOYSA-N.
| Molecular formula | C16H22N2O4 |
|---|---|
| Molecular weight | 306.36 g/mol |
| IUPAC name | tert-butyl 4-(4-nitrophenyl)piperidine-1-carboxylate |
| InChIKey | HNXBHNXMRSXDRQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(CC1)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)