cas: 1219220-82-2 — see every product listed under this CAS number, including other names
1-Boc-Azetidine-2-carboxylic acid amide (CAS 1219220-82-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040521-250MG |
| cas | 1219220-82-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 2018.06 Pln | |
| Fluorochem | 1g | 3283.24 Pln | |
| Fluorochem | 5g | 13566.07 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl 2-carbamoylazetidine-1-carboxylate (CAS 1219220-82-2) is a chemical compound with the molecular formula C9H16N2O3 and a molecular weight of 200.23 g/mol. IUPAC name: tert-butyl 2-carbamoylazetidine-1-carboxylate. InChIKey: NDEIKFCAPOYPHU-UHFFFAOYSA-N.
| Molecular formula | C9H16N2O3 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | tert-butyl 2-carbamoylazetidine-1-carboxylate |
| InChIKey | NDEIKFCAPOYPHU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC1C(=O)N |
Computed by PubChem (NCBI)