cas: 83435-58-9 — see every product listed under this CAS number, including other names
1-Boc-D-Prolinol, 97% (CAS 83435-58-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F036673-1G |
| cas | 83435-58-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 159.34 Pln | |
| Fluorochem | 100g | 409.25 Pln | |
| Fluorochem | 500g | 1601.54 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Tert-butyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate (CAS 83435-58-9) is a chemical compound with the molecular formula C10H19NO3 and a molecular weight of 201.26 g/mol. IUPAC name: tert-butyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate. InChIKey: BFFLLBPMZCIGRM-MRVPVSSYSA-N.
| Molecular formula | C10H19NO3 |
|---|---|
| Molecular weight | 201.26 g/mol |
| IUPAC name | tert-butyl (2R)-2-(hydroxymethyl)pyrrolidine-1-carboxylate |
| InChIKey | BFFLLBPMZCIGRM-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@H]1CO |
Computed by PubChem (NCBI)