cas: 59378-75-5 — see every product listed under this CAS number, including other names
1-Boc-pyrrolidine-3-carboxylic acid, 97% (CAS 59378-75-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 1g, 100g, 10g, 250g, 500g. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | OR-2443-25g |
| cas | 59378-75-5 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 100g | price on request | |
| Fluorochem | 1g | 91.65 Pln | |
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 221.81 Pln | |
| Fluorochem | 100g | 690.40 Pln | |
| Fluorochem | 250g | 1643.19 Pln | |
| Fluorochem | 500g | 3236.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid (CAS 59378-75-5) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: 1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid. InChIKey: HRMRQBJUFWFQLX-UHFFFAOYSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | 1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-3-carboxylic acid |
| InChIKey | HRMRQBJUFWFQLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(C1)C(=O)O |
Computed by PubChem (NCBI)