cas: 960309-88-0 — see every product listed under this CAS number, including other names
1-Bromo-2-(1,1-dimethylethoxy)-4-fluorobenzene, 98% (CAS 960309-88-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F631211-100MG |
| cas | 960309-88-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 700.81 Pln | |
| Fluorochem | 250mg | 1158.98 Pln | |
| Fluorochem | 1g | 3033.32 Pln | |
| Fluorochem | 5g | 10468.21 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-4-fluoro-2-[(2-methylpropan-2-yl)oxy]benzene (CAS 960309-88-0) is a chemical compound with the molecular formula C10H12BrFO and a molecular weight of 247.10 g/mol. IUPAC name: 1-bromo-4-fluoro-2-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: YSYOBWIBVCCPFG-UHFFFAOYSA-N.
| Molecular formula | C10H12BrFO |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | 1-bromo-4-fluoro-2-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | YSYOBWIBVCCPFG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=C(C=CC(=C1)F)Br |
Computed by PubChem (NCBI)