cas: 791088-70-5 — see every product listed under this CAS number, including other names
1-Bromo-2-(propan-2-yloxy)naphthalene (CAS 791088-70-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632669-1G |
| cas | 791088-70-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 3038.53 Pln | |
| Fluorochem | 5g | 8973.94 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-2-propan-2-yloxynaphthalene (CAS 791088-70-5) is a chemical compound with the molecular formula C13H13BrO and a molecular weight of 265.14 g/mol. IUPAC name: 1-bromo-2-propan-2-yloxynaphthalene. InChIKey: YCMYHIJIIDASRU-UHFFFAOYSA-N.
| Molecular formula | C13H13BrO |
|---|---|
| Molecular weight | 265.14 g/mol |
| IUPAC name | 1-bromo-2-propan-2-yloxynaphthalene |
| InChIKey | YCMYHIJIIDASRU-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(C2=CC=CC=C2C=C1)Br |
Computed by PubChem (NCBI)