cas: 1417568-88-7 — see every product listed under this CAS number, including other names
1-Bromo-2-chloro-3-(trifluoromethoxy)benzene 98% (CAS 1417568-88-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A257845-250mg |
| cas | 1417568-88-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 854.31 Pln | |
| Ambeed | 5g | 2951.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A257845 |
1-bromo-2-chloro-3-(trifluoromethoxy)benzene (CAS 1417568-88-7) is a chemical compound with the molecular formula C7H3BrClF3O and a molecular weight of 275.45 g/mol. IUPAC name: 1-bromo-2-chloro-3-(trifluoromethoxy)benzene. InChIKey: GTHBPCGHWPQHLT-UHFFFAOYSA-N.
| Molecular formula | C7H3BrClF3O |
|---|---|
| Molecular weight | 275.45 g/mol |
| IUPAC name | 1-bromo-2-chloro-3-(trifluoromethoxy)benzene |
| InChIKey | GTHBPCGHWPQHLT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Br)Cl)OC(F)(F)F |
Computed by PubChem (NCBI)