cas: 1805937-72-7 — see every product listed under this CAS number, including other names
1-Bromo-2-fluoro-3-nitro-5-(trifluoromethyl)benzene 97% (CAS 1805937-72-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A968964-250mg |
| cas | 1805937-72-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1171.38 Pln | |
| Ambeed | 25g | 3841.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A968964 |
1-bromo-2-fluoro-3-nitro-5-(trifluoromethyl)benzene (CAS 1805937-72-7) is a chemical compound with the molecular formula C7H2BrF4NO2 and a molecular weight of 287.99 g/mol. IUPAC name: 1-bromo-2-fluoro-3-nitro-5-(trifluoromethyl)benzene. InChIKey: SRLDZKXOCHTLHB-UHFFFAOYSA-N.
| Molecular formula | C7H2BrF4NO2 |
|---|---|
| Molecular weight | 287.99 g/mol |
| IUPAC name | 1-bromo-2-fluoro-3-nitro-5-(trifluoromethyl)benzene |
| InChIKey | SRLDZKXOCHTLHB-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)Br)C(F)(F)F |
Computed by PubChem (NCBI)