cas: 1352317-80-6 — see every product listed under this CAS number, including other names
1-Bromo-2-fluoro-4-methoxy-3-nitrobenzene, 95% (CAS 1352317-80-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F460873-100MG |
| cas | 1352317-80-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 284.29 Pln | |
| Fluorochem | 1g | 482.14 Pln | |
| Fluorochem | 5g | 1684.84 Pln | |
| Fluorochem | 10g | 3106.22 Pln | |
| Fluorochem | 25g | 6375.90 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-bromo-2-fluoro-4-methoxy-3-nitrobenzene (CAS 1352317-80-6) is a chemical compound with the molecular formula C7H5BrFNO3 and a molecular weight of 250.02 g/mol. IUPAC name: 1-bromo-2-fluoro-4-methoxy-3-nitrobenzene. InChIKey: LJJAOMRFFXQENV-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO3 |
|---|---|
| Molecular weight | 250.02 g/mol |
| IUPAC name | 1-bromo-2-fluoro-4-methoxy-3-nitrobenzene |
| InChIKey | LJJAOMRFFXQENV-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)Br)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)