cas: 1121586-26-2 — see every product listed under this CAS number, including other names
1-Bromo-2-iodo-4-(trifluoromethoxy)benzene, 98%, 98% (CAS 1121586-26-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118UFU-100mg |
| cas | 1121586-26-2 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 117.20 Pln | |
| Chemat | 250mg | 141.20 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 928.40 Pln | |
| Chemat | 10g | 1562.00 Pln | |
| Chemat | 25g | 3054.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-2-iodo-4-(trifluoromethoxy)benzene (CAS 1121586-26-2) is a chemical compound with the molecular formula C7H3BrF3IO and a molecular weight of 366.90 g/mol. IUPAC name: 1-bromo-2-iodo-4-(trifluoromethoxy)benzene. InChIKey: AFKTVNYRQWCNTJ-UHFFFAOYSA-N.
| Molecular formula | C7H3BrF3IO |
|---|---|
| Molecular weight | 366.90 g/mol |
| IUPAC name | 1-bromo-2-iodo-4-(trifluoromethoxy)benzene |
| InChIKey | AFKTVNYRQWCNTJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1OC(F)(F)F)I)Br |
Computed by PubChem (NCBI)