cas: 2728-70-3 — see every product listed under this CAS number, including other names
1-Bromo-3-((trifluoromethyl)sulfonyl)benzene 97% (CAS 2728-70-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A104974-100mg |
| cas | 2728-70-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 464.94 Pln | |
| Ambeed | 250mg | 648.50 Pln | |
| Ambeed | 1g | 1538.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A104974 |
1-bromo-3-(trifluoromethylsulfonyl)benzene (CAS 2728-70-3) is a chemical compound with the molecular formula C7H4BrF3O2S and a molecular weight of 289.07 g/mol. IUPAC name: 1-bromo-3-(trifluoromethylsulfonyl)benzene. InChIKey: VHAFOFLCIMSUTR-UHFFFAOYSA-N.
| Molecular formula | C7H4BrF3O2S |
|---|---|
| Molecular weight | 289.07 g/mol |
| IUPAC name | 1-bromo-3-(trifluoromethylsulfonyl)benzene |
| InChIKey | VHAFOFLCIMSUTR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)