cas: 889362-81-6 — see every product listed under this CAS number, including other names
1-Bromo-3-(1,1-dimethylethoxy)-5-fluorobenzene (CAS 889362-81-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632618-5G |
| cas | 889362-81-6 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 7568.19 Pln | |
| Fluorochem | 1g | 2569.95 Pln |
| delivery time | 3-4 weeks |
|---|
1-bromo-3-fluoro-5-[(2-methylpropan-2-yl)oxy]benzene (CAS 889362-81-6) is a chemical compound with the molecular formula C10H12BrFO and a molecular weight of 247.10 g/mol. IUPAC name: 1-bromo-3-fluoro-5-[(2-methylpropan-2-yl)oxy]benzene. InChIKey: YXOCRSISEUGDAP-UHFFFAOYSA-N.
| Molecular formula | C10H12BrFO |
|---|---|
| Molecular weight | 247.10 g/mol |
| IUPAC name | 1-bromo-3-fluoro-5-[(2-methylpropan-2-yl)oxy]benzene |
| InChIKey | YXOCRSISEUGDAP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC1=CC(=CC(=C1)Br)F |
Computed by PubChem (NCBI)