cas: 1123172-38-2 — see every product listed under this CAS number, including other names
1-Bromo-3-(tert-butyl)-5-fluorobenzene 97% (CAS 1123172-38-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A154948-10g |
| cas | 1123172-38-2 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 3952.62 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 2189.31 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A154948 |
1-bromo-3-tert-butyl-5-fluorobenzene (CAS 1123172-38-2) is a chemical compound with the molecular formula C10H12BrF and a molecular weight of 231.10 g/mol. IUPAC name: 1-bromo-3-tert-butyl-5-fluorobenzene. InChIKey: NEZOQSYMVSKUSO-UHFFFAOYSA-N.
| Molecular formula | C10H12BrF |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 1-bromo-3-tert-butyl-5-fluorobenzene |
| InChIKey | NEZOQSYMVSKUSO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=CC(=C1)Br)F |
Computed by PubChem (NCBI)