cas: 164352-24-3 — see every product listed under this CAS number, including other names
1-Bromo-4-((2-ethylhexyl)oxy)benzene, 95%, 95% (CAS 164352-24-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112UTE-250mg |
| cas | 164352-24-3 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 189.20 Pln | |
| Chemat | 5g | 578.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-(2-ethylhexoxy)benzene (CAS 164352-24-3) is a chemical compound with the molecular formula C14H21BrO and a molecular weight of 285.22 g/mol. IUPAC name: 1-bromo-4-(2-ethylhexoxy)benzene. InChIKey: PLKHKVHXKXGJAO-UHFFFAOYSA-N.
| Molecular formula | C14H21BrO |
|---|---|
| Molecular weight | 285.22 g/mol |
| IUPAC name | 1-bromo-4-(2-ethylhexoxy)benzene |
| InChIKey | PLKHKVHXKXGJAO-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC1=CC=C(C=C1)Br |
Computed by PubChem (NCBI)