cas: 79832-89-6 — see every product listed under this CAS number, including other names
1-Bromo-4-(trans-4-N-pentylcyclohexyl)benzene, 98%, 98% (CAS 79832-89-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11614W-5g |
| cas | 79832-89-6 |
| size | 5g |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 74.00 Pln | |
| Chemat | 10g | 83.60 Pln | |
| Chemat | 25g | 102.80 Pln | |
| Chemat | 100g | 232.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-bromo-4-(4-pentylcyclohexyl)benzene (CAS 79832-89-6) is a chemical compound with the molecular formula C17H25Br and a molecular weight of 309.3 g/mol. IUPAC name: 1-bromo-4-(4-pentylcyclohexyl)benzene. InChIKey: QUWHOIKFJBTGHZ-UHFFFAOYSA-N.
| Molecular formula | C17H25Br |
|---|---|
| Molecular weight | 309.3 g/mol |
| IUPAC name | 1-bromo-4-(4-pentylcyclohexyl)benzene |
| InChIKey | QUWHOIKFJBTGHZ-UHFFFAOYSA-N |
| SMILES | CCCCCC1CCC(CC1)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)