cas: 1242070-95-6 — see every product listed under this CAS number, including other names
1-Bromo-4-butoxy-3,5,-dichlorobenzene (CAS 1242070-95-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632600-1G |
| cas | 1242070-95-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 924.69 Pln | |
| Fluorochem | 5g | 2637.63 Pln |
| delivery time | 3-4 weeks |
|---|
5-bromo-2-butoxy-1,3-dichlorobenzene (CAS 1242070-95-6) is a chemical compound with the molecular formula C10H11BrCl2O and a molecular weight of 298.00 g/mol. IUPAC name: 5-bromo-2-butoxy-1,3-dichlorobenzene. InChIKey: JJTBAFFOGJDIEJ-UHFFFAOYSA-N.
| Molecular formula | C10H11BrCl2O |
|---|---|
| Molecular weight | 298.00 g/mol |
| IUPAC name | 5-bromo-2-butoxy-1,3-dichlorobenzene |
| InChIKey | JJTBAFFOGJDIEJ-UHFFFAOYSA-N |
| SMILES | CCCCOC1=C(C=C(C=C1Cl)Br)Cl |
Computed by PubChem (NCBI)