1-Bromo-6-methoxyisoquinoline, 95%
cas: 1196152-83-6 — see every product listed under this CAS number, including other names
1-Bromo-6-methoxyisoquinoline, 95% (CAS 1196152-83-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1108338-250mg |
| cas | 1196152-83-6 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1338.25 Pln | |
| Ambeed | 1g | 3490.94 Pln | |
| BLDpharm | 100mg | 808.63 Pln | |
| BLDpharm | 250mg | 1314.01 Pln | |
| BLDpharm | 1g | 3424.37 Pln | |
| Chemat | 100mg | 597.20 Pln | |
| Chemat | 250mg | 1130.00 Pln | |
| Chemat | 1g | 3261.20 Pln | |
| Fluorochem | 100mg | 1101.71 Pln | |
| Fluorochem | 250mg | 2090.95 Pln | |
| Fluorochem | 1g | 6047.89 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-bromo-6-methoxyisoquinoline (CAS 1196152-83-6) is a chemical compound with the molecular formula C10H8BrNO and a molecular weight of 238.08 g/mol. IUPAC name: 1-bromo-6-methoxyisoquinoline. InChIKey: CDEUKMWYVZMNFN-UHFFFAOYSA-N.
| Molecular formula | C10H8BrNO |
|---|---|
| Molecular weight | 238.08 g/mol |
| IUPAC name | 1-bromo-6-methoxyisoquinoline |
| InChIKey | CDEUKMWYVZMNFN-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(=NC=C2)Br |
Computed by PubChem (NCBI)