cas: 1033461-45-8 — see every product listed under this CAS number, including other names
1-Butyl-3-vinyliMidazoliuM broMide, 98%, 98% (CAS 1033461-45-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114E7I-1g |
| cas | 1033461-45-8 |
| size | 1g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 179.60 Pln | |
| Chemat | 100g | 496.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-butyl-3-ethenylimidazol-1-ium bromide (CAS 1033461-45-8) is a chemical compound with the molecular formula C9H15BrN2 and a molecular weight of 231.13 g/mol. IUPAC name: 1-butyl-3-ethenylimidazol-1-ium bromide. InChIKey: XALVOFYVVOAYPO-UHFFFAOYSA-M.
| Molecular formula | C9H15BrN2 |
|---|---|
| Molecular weight | 231.13 g/mol |
| IUPAC name | 1-butyl-3-ethenylimidazol-1-ium bromide |
| InChIKey | XALVOFYVVOAYPO-UHFFFAOYSA-M |
| SMILES | CCCC[N+]1=CN(C=C1)C=C.[Br-] |
Computed by PubChem (NCBI)