cas: 782-08-1 — see every product listed under this CAS number, including other names
1-CHLORO-4-[CHLORO(4-CHLOROPHENYL)METHYL]BENZENE, 95% (CAS 782-08-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F844517-100MG |
| cas | 782-08-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 357.18 Pln | |
| Fluorochem | 250mg | 508.17 Pln | |
| Fluorochem | 1g | 1153.78 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-chloro-4-[chloro-(4-chlorophenyl)methyl]benzene (CAS 782-08-1) is a chemical compound with the molecular formula C13H9Cl3 and a molecular weight of 271.6 g/mol. IUPAC name: 1-chloro-4-[chloro-(4-chlorophenyl)methyl]benzene. InChIKey: LKBJQRZQDCMBBJ-UHFFFAOYSA-N.
| Molecular formula | C13H9Cl3 |
|---|---|
| Molecular weight | 271.6 g/mol |
| IUPAC name | 1-chloro-4-[chloro-(4-chlorophenyl)methyl]benzene |
| InChIKey | LKBJQRZQDCMBBJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)Cl)Cl)Cl |
Computed by PubChem (NCBI)