cas: 159275-17-9 — see every product listed under this CAS number, including other names
1-Cbz-4-(Bromomethyl)piperidine, 95% (CAS 159275-17-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049012-1G |
| cas | 159275-17-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 2g | 320.74 Pln | |
| Fluorochem | 5g | 659.16 Pln | |
| Fluorochem | 25g | 2184.67 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
Benzyl 4-(bromomethyl)piperidine-1-carboxylate (CAS 159275-17-9) is a chemical compound with the molecular formula C14H18BrNO2 and a molecular weight of 312.20 g/mol. IUPAC name: benzyl 4-(bromomethyl)piperidine-1-carboxylate. InChIKey: XJHKDSZGAWXUTB-UHFFFAOYSA-N.
| Molecular formula | C14H18BrNO2 |
|---|---|
| Molecular weight | 312.20 g/mol |
| IUPAC name | benzyl 4-(bromomethyl)piperidine-1-carboxylate |
| InChIKey | XJHKDSZGAWXUTB-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1CBr)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)