cas: 16582-38-0 — see every product listed under this CAS number, including other names
1-Chloro-3-methyl-5-nitrobenzene 97% (CAS 16582-38-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A103209-1g |
| cas | 16582-38-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 220.19 Pln | |
| Ambeed | 25g | 253.56 Pln | |
| Ambeed | 100g | 565.06 Pln | |
| Ambeed | 500g | 2061.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A103209 |
1-chloro-3-methyl-5-nitrobenzene (CAS 16582-38-0) is a chemical compound with the molecular formula C7H6ClNO2 and a molecular weight of 171.58 g/mol. IUPAC name: 1-chloro-3-methyl-5-nitrobenzene. InChIKey: IYHHGLULQDOFGC-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO2 |
|---|---|
| Molecular weight | 171.58 g/mol |
| IUPAC name | 1-chloro-3-methyl-5-nitrobenzene |
| InChIKey | IYHHGLULQDOFGC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)