cas: 435278-06-1 — see every product listed under this CAS number, including other names
1-Chloro-4-fluoroisoquinoline, 97%, 97% (CAS 435278-06-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DLBO-100mg |
| cas | 435278-06-1 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 472.40 Pln | |
| Chemat | 500mg | 674.00 Pln | |
| Chemat | 1g | 1082.00 Pln | |
| Chemat | 5g | 3126.80 Pln | |
| Chemat | 10g | 5166.80 Pln | |
| Chemat | 25g | 10274.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-chloro-4-fluoroisoquinoline (CAS 435278-06-1) is a chemical compound with the molecular formula C9H5ClFN and a molecular weight of 181.59 g/mol. IUPAC name: 1-chloro-4-fluoroisoquinoline. InChIKey: BKYLDYWBJSOIMD-UHFFFAOYSA-N.
| Molecular formula | C9H5ClFN |
|---|---|
| Molecular weight | 181.59 g/mol |
| IUPAC name | 1-chloro-4-fluoroisoquinoline |
| InChIKey | BKYLDYWBJSOIMD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=C2Cl)F |
Computed by PubChem (NCBI)