1-Chloronaphthalene-5-boronic acid, 98%
cas: 2142655-40-9 — see every product listed under this CAS number, including other names
1-Chloronaphthalene-5-boronic acid, 98% (CAS 2142655-40-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F623655-100MG |
| cas | 2142655-40-9 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 836.18 Pln | |
| Fluorochem | 250mg | 1294.35 Pln | |
| Fluorochem | 1g | 3199.93 Pln | |
| Fluorochem | 5g | 10702.50 Pln | |
| Ambeed | 250mg | 793.12 Pln | |
| Ambeed | 1g | 1816.62 Pln | |
| Ambeed | 5g | 6094.19 Pln | |
| BLDpharm | 100mg | 536.50 Pln | |
| BLDpharm | 250mg | 853.06 Pln | |
| BLDpharm | 1g | 1952.67 Pln | |
| BLDpharm | 5g | 6562.16 Pln | |
| Chemat | 100mg | 582.80 Pln | |
| Chemat | 250mg | 890.00 Pln | |
| Chemat | 1g | 2214.80 Pln | |
| Chemat | 5g | 7600.40 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
(5-chloronaphthalen-1-yl)boronic acid (CAS 2142655-40-9) is a chemical compound with the molecular formula C10H8BClO2 and a molecular weight of 206.43 g/mol. IUPAC name: (5-chloronaphthalen-1-yl)boronic acid. InChIKey: BSSDYINOXISHRI-UHFFFAOYSA-N.
| Molecular formula | C10H8BClO2 |
|---|---|
| Molecular weight | 206.43 g/mol |
| IUPAC name | (5-chloronaphthalen-1-yl)boronic acid |
| InChIKey | BSSDYINOXISHRI-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC=C(C2=CC=C1)Cl)(O)O |
Computed by PubChem (NCBI)