cas: 59016-56-7 — see every product listed under this CAS number, including other names
1-Cyano-4-dimethylaminopyridinium tetrafluoroborate (CAS 59016-56-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM00690W-100mg |
| cas | 59016-56-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 766.66 Pln | |
| Chemat | 500mg | 2052.11 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
4-(dimethylamino)pyridin-1-ium-1-carbonitrile tetrafluoroborate (CAS 59016-56-7) is a chemical compound with the molecular formula C8H10BF4N3 and a molecular weight of 234.99 g/mol. IUPAC name: 4-(dimethylamino)pyridin-1-ium-1-carbonitrile tetrafluoroborate. InChIKey: MBLVMDCQDCVKNE-UHFFFAOYSA-N.
| Molecular formula | C8H10BF4N3 |
|---|---|
| Molecular weight | 234.99 g/mol |
| IUPAC name | 4-(dimethylamino)pyridin-1-ium-1-carbonitrile tetrafluoroborate |
| InChIKey | MBLVMDCQDCVKNE-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CN(C)C1=CC=[N+](C=C1)C#N |
Computed by PubChem (NCBI)