cas: 103460-89-5 — see every product listed under this CAS number, including other names
1-Cyclopropyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxo-1,4-dihydroquinoline-3-carboxylic acid, 95%, 95% (CAS 103460-89-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118XI0-250mg |
| cas | 103460-89-5 |
| size | 250mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 342.80 Pln | |
| Chemat | 1g | 1086.80 Pln | |
| Chemat | 5g | 3650.00 Pln | |
| Chemat | 100mg | 275.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-cyclopropyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid (CAS 103460-89-5) is a chemical compound with the molecular formula C18H19F2N3O3 and a molecular weight of 363.4 g/mol. IUPAC name: 1-cyclopropyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid. InChIKey: ZHKOPMSOBOQYRH-UHFFFAOYSA-N.
| Molecular formula | C18H19F2N3O3 |
|---|---|
| Molecular weight | 363.4 g/mol |
| IUPAC name | 1-cyclopropyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| InChIKey | ZHKOPMSOBOQYRH-UHFFFAOYSA-N |
| SMILES | CC1CN(CCN1)C2=C(C=C3C(=C2F)N(C=C(C3=O)C(=O)O)C4CC4)F |
Computed by PubChem (NCBI)