cas: 850331-04-3 — see every product listed under this CAS number, including other names
1-Ethyl-3-methyl-1H-imidazol-3-ium tetrachloroferrate(III), 98%, 98% (CAS 850331-04-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 15g, 1g, 5g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114EAY-10g |
| cas | 850331-04-3 |
| size | 10g |
| availability | 300g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 227.60 Pln | |
| Chemat | 15g | 304.40 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 25g | 429.20 Pln | |
| Chemat | 100g | 1475.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-ethyl-3-methylimidazol-3-ium;tetrachloroiron(1-) (CAS 850331-04-3) is a chemical compound with the molecular formula C6H11Cl4FeN2 and a molecular weight of 308.8 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium;tetrachloroiron(1-). InChIKey: VGSZFQMHQHFXCD-UHFFFAOYSA-J.
| Molecular formula | C6H11Cl4FeN2 |
|---|---|
| Molecular weight | 308.8 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium;tetrachloroiron(1-) |
| InChIKey | VGSZFQMHQHFXCD-UHFFFAOYSA-J |
| SMILES | CCN1C=C[N+](=C1)C.Cl[Fe-](Cl)(Cl)Cl |
Computed by PubChem (NCBI)