1-Ethyl-3-methylimidazolium acetate, 98%, 98%
cas: 143314-17-4 — see every product listed under this CAS number, including other names
1-Ethyl-3-methylimidazolium acetate, 98%, 98% (CAS 143314-17-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11494P-1g |
| cas | 143314-17-4 |
| size | 1g |
| availability | 10000g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 93.20 Pln | |
| Chemat | 25g | 131.60 Pln | |
| Chemat | 50g | 184.40 Pln | |
| Chemat | 100g | 304.40 Pln | |
| Chemat | 250g | 654.80 Pln | |
| Chemat | 500g | 1257.60 Pln | |
| Chemat | 1kg | 2421.20 Pln | |
| Chemat | 5kg | 5668.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-ethyl-3-methylimidazol-3-ium acetate (CAS 143314-17-4) is a chemical compound with the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. IUPAC name: 1-ethyl-3-methylimidazol-3-ium acetate. InChIKey: XIYUIMLQTKODPS-UHFFFAOYSA-M.
| Molecular formula | C8H14N2O2 |
|---|---|
| Molecular weight | 170.21 g/mol |
| IUPAC name | 1-ethyl-3-methylimidazol-3-ium acetate |
| InChIKey | XIYUIMLQTKODPS-UHFFFAOYSA-M |
| SMILES | CCN1C=C[N+](=C1)C.CC(=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
1-Ethyl-3-methylimidazolium acetate, 1-ethyl-3-methylimidazol-3-ium;acetate, 1-Ethyl-3-methyl-3-imidazolium Acetate, 1-Ethyl-3-methyl-imidazol-3-ium acetate, 1-ethyl-3-methyl-1H-imidazol-3-ium acetate, EMIMAc, 3-Ethyl-1-methyl-1H-imidazol-3-ium acetate, 1-methyl-3-ethylimidazolium acetate, 3-ethyl-1-methylimidazolium acetate, 1-Ethyl-3-methylimidazoline acetate