1-Fluoro-2,6-bis(methoxycarbonyl)pyridin-1-ium trifluoromethanesulfonate, 97%
cas: 107264-08-4 — see every product listed under this CAS number, including other names
1-Fluoro-2,6-bis(methoxycarbonyl)pyridin-1-ium trifluoromethanesulfonate, 97% (CAS 107264-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F865306-100MG |
| cas | 107264-08-4 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 227.02 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 633.13 Pln | |
| Fluorochem | 5g | 2023.26 Pln | |
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 470.50 Pln | |
| Ambeed | 5g | 1488.44 Pln | |
| Ambeed | 10g | 2339.50 Pln | |
| Chemat | 100mg | 160.40 Pln | |
| Chemat | 250mg | 213.20 Pln | |
| Chemat | 1g | 434.00 Pln | |
| Chemat | 5g | 1403.60 Pln | |
| BLDpharm | 100mg | 192.18 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 464.31 Pln | |
| BLDpharm | 5g | 1463.95 Pln | |
| BLDpharm | 10g | 2302.55 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
Dimethyl 1-fluoropyridin-1-ium-2,6-dicarboxylate;trifluoromethanesulfonate (CAS 107264-08-4) is a chemical compound with the molecular formula C10H9F4NO7S and a molecular weight of 363.24 g/mol. IUPAC name: dimethyl 1-fluoropyridin-1-ium-2,6-dicarboxylate;trifluoromethanesulfonate. InChIKey: LDTLFVAJBQGQPV-UHFFFAOYSA-M.
| Molecular formula | C10H9F4NO7S |
|---|---|
| Molecular weight | 363.24 g/mol |
| IUPAC name | dimethyl 1-fluoropyridin-1-ium-2,6-dicarboxylate;trifluoromethanesulfonate |
| InChIKey | LDTLFVAJBQGQPV-UHFFFAOYSA-M |
| SMILES | COC(=O)C1=[N+](C(=CC=C1)C(=O)OC)F.C(F)(F)(F)S(=O)(=O)[O-] |
Computed by PubChem (NCBI)