cas: 2358-41-0 — see every product listed under this CAS number, including other names
1-Fluoro-2-((trifluoromethyl)sulfonyl)benzene, 97% (CAS 2358-41-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F214950-1G |
| cas | 2358-41-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 133.30 Pln | |
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 357.18 Pln | |
| Fluorochem | 25g | 732.05 Pln | |
| Fluorochem | 50g | 1138.16 Pln | |
| Fluorochem | 100g | 2158.63 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
1-fluoro-2-(trifluoromethylsulfonyl)benzene (CAS 2358-41-0) is a chemical compound with the molecular formula C7H4F4O2S and a molecular weight of 228.17 g/mol. IUPAC name: 1-fluoro-2-(trifluoromethylsulfonyl)benzene. InChIKey: NXZFXDLCZKKNCX-UHFFFAOYSA-N.
| Molecular formula | C7H4F4O2S |
|---|---|
| Molecular weight | 228.17 g/mol |
| IUPAC name | 1-fluoro-2-(trifluoromethylsulfonyl)benzene |
| InChIKey | NXZFXDLCZKKNCX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)F)S(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)