1-Hexyl-3-methylimidazolium tetrafluoroborate, 97%
cas: 244193-50-8 — see every product listed under this CAS number, including other names
1-Hexyl-3-methylimidazolium tetrafluoroborate, 97% (CAS 244193-50-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F386750-1G |
| cas | 244193-50-8 |
| size | 1g |
| availability | In Stock UK |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 107.27 Pln | |
| Fluorochem | 10g | 133.30 Pln | |
| Fluorochem | 25g | 206.20 Pln | |
| Fluorochem | 100g | 529.00 Pln | |
| Ambeed | 5g | 125.62 Pln | |
| Ambeed | 25g | 175.69 Pln | |
| Ambeed | 100g | 398.19 Pln | |
| Ambeed | 500g | 1705.38 Pln | |
| BLDpharm | 5g | 125.54 Pln | |
| BLDpharm | 25g | 186.63 Pln | |
| BLDpharm | 100g | 425.43 Pln | |
| BLDpharm | 500g | 1830.49 Pln |
properties
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
1-hexyl-3-methylimidazol-3-ium tetrafluoroborate (CAS 244193-50-8) is a chemical compound with the molecular formula C10H19BF4N2 and a molecular weight of 254.08 g/mol. IUPAC name: 1-hexyl-3-methylimidazol-3-ium tetrafluoroborate. InChIKey: MFXLOVLEQJRXFP-UHFFFAOYSA-N.
| Molecular formula | C10H19BF4N2 |
|---|---|
| Molecular weight | 254.08 g/mol |
| IUPAC name | 1-hexyl-3-methylimidazol-3-ium tetrafluoroborate |
| InChIKey | MFXLOVLEQJRXFP-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CCCCCCN1C=C[N+](=C1)C |
Computed by PubChem (NCBI)
Synonyms:
1-Hexyl-3-methylimidazolium tetrafluoroborate, 1-hexyl-3-methylimidazol-3-ium;tetrafluoroborate, 1-n-Hexyl-3-methylimidazolium tetrafluoroborate, 1-hexyl-3-methyl-1H-imidazol-3-ium tetrafluoroborate, 1-Hexyl-3-methylimidazoliumTetrafluoroborate, 1-hexyl-3-methylimidazol-3-ium,tetrafluoroborate, Tox21_202650, 1-hexyl-3-methyl-imidazol-3-ium;tetrafluoroborate, 1-Hexyl-3-methylimidazolium tetrafluoroborate [HMIm]BF4, 1-Hexyl-3-methyl-1H-imidazol-3-ium tetrafluoridoborate(1-)