CAS 34244-15-0 appears in our catalog under these names: 1-Iodopyrene, 95%, 1–Iodopyrene, 1-Iodopyrene, >98.0%(GC), 1-Iodopyrene, >98.0%(GC), >98.0%(GC), 1-IODOPYRENE, ≥97%. Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 200mg, 20mg, 100mg, 50mg.
1-iodopyrene (CAS 34244-15-0) is a chemical compound with the molecular formula C16H9I and a molecular weight of 328.15 g/mol. IUPAC name: 1-iodopyrene. InChIKey: CWNJSSNWLUIMDP-UHFFFAOYSA-N.
| Molecular formula | C16H9I |
|---|---|
| Molecular weight | 328.15 g/mol |
| IUPAC name | 1-iodopyrene |
| InChIKey | CWNJSSNWLUIMDP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)I |
Computed by PubChem (NCBI)