CAS 857784-97-5 appears in our catalog under these names: 1-Iododibenzo[b,d]furan, 97%, 97%, 1-Iododibenzo[b,d]furan, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
1-iododibenzofuran (CAS 857784-97-5) is a chemical compound with the molecular formula C12H7IO and a molecular weight of 294.09 g/mol. IUPAC name: 1-iododibenzofuran. InChIKey: UPOAJQCHRDVQEZ-UHFFFAOYSA-N.
| Molecular formula | C12H7IO |
|---|---|
| Molecular weight | 294.09 g/mol |
| IUPAC name | 1-iododibenzofuran |
| InChIKey | UPOAJQCHRDVQEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC=C3I |
Computed by PubChem (NCBI)