cas: 1073354-18-3 — see every product listed under this CAS number, including other names
1-Isopropyl-4-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)piperazine, 98% (CAS 1073354-18-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F217253-250MG |
| cas | 1073354-18-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 841.39 Pln | |
| Fluorochem | 5g | 3975.70 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-propan-2-yl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine (CAS 1073354-18-3) is a chemical compound with the molecular formula C19H31BN2O2 and a molecular weight of 330.3 g/mol. IUPAC name: 1-propan-2-yl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine. InChIKey: CSORKGLMGUQQOY-UHFFFAOYSA-N.
| Molecular formula | C19H31BN2O2 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | 1-propan-2-yl-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]piperazine |
| InChIKey | CSORKGLMGUQQOY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)N3CCN(CC3)C(C)C |
Computed by PubChem (NCBI)