cas: 267413-29-6 — see every product listed under this CAS number, including other names
1-METHYL-1H-INDAZOLE-6-CARBONITRILE, 98% (CAS 267413-29-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F471653-100MG |
| cas | 267413-29-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 346.77 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 1g | 1481.79 Pln | |
| Fluorochem | 5g | 5886.49 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-methylindazole-6-carbonitrile (CAS 267413-29-6) is a chemical compound with the molecular formula C9H7N3 and a molecular weight of 157.17 g/mol. IUPAC name: 1-methylindazole-6-carbonitrile. InChIKey: WMKXQAVXMOAOAG-UHFFFAOYSA-N.
| Molecular formula | C9H7N3 |
|---|---|
| Molecular weight | 157.17 g/mol |
| IUPAC name | 1-methylindazole-6-carbonitrile |
| InChIKey | WMKXQAVXMOAOAG-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=C2)C#N)C=N1 |
Computed by PubChem (NCBI)