CAS 117029-34-2 appears in our catalog under these names: 1-Methylpyridinium Hexafluorophosphate, 98%, 1–Methylpyridin–1–ium Hexafluorophosphate(V), 1-Methylpyridinium Hexafluorophosphate, >98.0%(HPLC), 1-Methylpyridinium Hexafluorophosphate, 1-METHYLPYRIDINIUM HEXAFLUOROPHOSPHATE, ≥98%. Offered by: AmBeed, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 100g, 25g, 5g.
1-methylpyridin-1-ium hexafluorophosphate (CAS 117029-34-2) is a chemical compound with the molecular formula C6H8F6NP and a molecular weight of 239.10 g/mol. IUPAC name: 1-methylpyridin-1-ium hexafluorophosphate. InChIKey: CNMJHBIAUIMMNJ-UHFFFAOYSA-N.
| Molecular formula | C6H8F6NP |
|---|---|
| Molecular weight | 239.10 g/mol |
| IUPAC name | 1-methylpyridin-1-ium hexafluorophosphate |
| InChIKey | CNMJHBIAUIMMNJ-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC=CC=C1.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)