1-Methyl-10H-phenothiazine, 98%
cas: 4020-30-8 — see every product listed under this CAS number, including other names
1-Methyl-10H-phenothiazine, 98% (CAS 4020-30-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1909183-50mg |
| cas | 4020-30-8 |
| size | 50mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 331.44 Pln | |
| Ambeed | 100mg | 503.88 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2178.19 Pln | |
| BLDpharm | 50mg | 347.68 Pln | |
| BLDpharm | 100mg | 536.50 Pln | |
| BLDpharm | 250mg | 914.15 Pln | |
| BLDpharm | 1g | 2341.42 Pln | |
| Chemat | 50mg | 174.80 Pln | |
| Chemat | 100mg | 266.00 Pln | |
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 717.20 Pln | |
| Fluorochem | 50mg | 331.15 Pln | |
| Fluorochem | 100mg | 513.38 Pln | |
| Fluorochem | 250mg | 883.04 Pln | |
| Fluorochem | 1g | 2241.94 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
1-methyl-10H-phenothiazine (CAS 4020-30-8) is a chemical compound with the molecular formula C13H11NS and a molecular weight of 213.30 g/mol. IUPAC name: 1-methyl-10H-phenothiazine. InChIKey: DGYYJSHANXEPSK-UHFFFAOYSA-N.
| Molecular formula | C13H11NS |
|---|---|
| Molecular weight | 213.30 g/mol |
| IUPAC name | 1-methyl-10H-phenothiazine |
| InChIKey | DGYYJSHANXEPSK-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)SC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)