cas: 92891-23-1 — see every product listed under this CAS number, including other names
1-Methyl-2-nitro-3-(trifluoromethyl)benzene, 97%+(GC-MS),RG, 97%+(GC-MS),RG (CAS 92891-23-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GVXO-1g |
| cas | 92891-23-1 |
| size | 1g |
| availability | 45g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 654.80 Pln | |
| Chemat | 5g | 2781.20 Pln |
| purity | 97%+(GC-MS),RG |
|---|---|
| delivery time | 3 weeks |
1-methyl-2-nitro-3-(trifluoromethyl)benzene (CAS 92891-23-1) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 1-methyl-2-nitro-3-(trifluoromethyl)benzene. InChIKey: JTXZOTTYGWMNGR-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 1-methyl-2-nitro-3-(trifluoromethyl)benzene |
| InChIKey | JTXZOTTYGWMNGR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(F)(F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)