CAS 953059-43-3 is the registry number for 1-Methyl-3-(3-sulfopropyl)-1H-imidazol-3-ium dihydrogen phosphate, 95%. Offered by: Ambeed. Available pack sizes: 25g, 5g.
Dihydrogen phosphate;3-(3-methylimidazol-3-ium-1-yl)propane-1-sulfonic acid (CAS 953059-43-3) is a chemical compound with the molecular formula C7H15N2O7PS and a molecular weight of 302.24 g/mol. IUPAC name: dihydrogen phosphate;3-(3-methylimidazol-3-ium-1-yl)propane-1-sulfonic acid. InChIKey: HJYAQNCBCSPAGU-UHFFFAOYSA-N.
| Molecular formula | C7H15N2O7PS |
|---|---|
| Molecular weight | 302.24 g/mol |
| IUPAC name | dihydrogen phosphate;3-(3-methylimidazol-3-ium-1-yl)propane-1-sulfonic acid |
| InChIKey | HJYAQNCBCSPAGU-UHFFFAOYSA-N |
| SMILES | C[N+]1=CN(C=C1)CCCS(=O)(=O)O.OP(=O)(O)[O-] |
Computed by PubChem (NCBI)