cas: 874290-99-0 — see every product listed under this CAS number, including other names
1-Methyl-3-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)urea, 98%, 98% (CAS 874290-99-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1147B8-100mg |
| cas | 874290-99-0 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 357.20 Pln | |
| Chemat | 5g | 1014.80 Pln | |
| Chemat | 10g | 1682.00 Pln | |
| Chemat | 25g | 3400.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea (CAS 874290-99-0) is a chemical compound with the molecular formula C14H21BN2O3 and a molecular weight of 276.14 g/mol. IUPAC name: 1-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea. InChIKey: MRHQTDZUJNAZGQ-UHFFFAOYSA-N.
| Molecular formula | C14H21BN2O3 |
|---|---|
| Molecular weight | 276.14 g/mol |
| IUPAC name | 1-methyl-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]urea |
| InChIKey | MRHQTDZUJNAZGQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)NC(=O)NC |
Computed by PubChem (NCBI)