cas: 128225-66-1 — see every product listed under this CAS number, including other names
1-Methyl-3-(trifluoromethyl)-1H-pyrazole-4-carbaldehyde, 98% (CAS 128225-66-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092034-250MG |
| cas | 128225-66-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 883.04 Pln | |
| Fluorochem | 5g | 2668.87 Pln | |
| Fluorochem | 10g | 4423.46 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-methyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde (CAS 128225-66-1) is a chemical compound with the molecular formula C6H5F3N2O and a molecular weight of 178.11 g/mol. IUPAC name: 1-methyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde. InChIKey: QNEXGLZIJJETOO-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O |
|---|---|
| Molecular weight | 178.11 g/mol |
| IUPAC name | 1-methyl-3-(trifluoromethyl)pyrazole-4-carbaldehyde |
| InChIKey | QNEXGLZIJJETOO-UHFFFAOYSA-N |
| SMILES | CN1C=C(C(=N1)C(F)(F)F)C=O |
Computed by PubChem (NCBI)