cas: 1414962-92-7 — see every product listed under this CAS number, including other names
1-Methyl-3-(trifluoromethyl)-1H-pyrazole-5-carbaldehyde, 98%, 98% (CAS 1414962-92-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GHR-100mg |
| cas | 1414962-92-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 198.80 Pln | |
| Chemat | 250mg | 290.00 Pln | |
| Chemat | 500mg | 515.60 Pln | |
| Chemat | 1g | 544.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-methyl-3-(trifluoromethyl)pyrazole-5-carbaldehyde (CAS 1414962-92-7) is a chemical compound with the molecular formula C6H5F3N2O and a molecular weight of 178.11 g/mol. IUPAC name: 1-methyl-3-(trifluoromethyl)pyrazole-5-carbaldehyde. InChIKey: CADUHCIARDLTEA-UHFFFAOYSA-N.
| Molecular formula | C6H5F3N2O |
|---|---|
| Molecular weight | 178.11 g/mol |
| IUPAC name | 1-methyl-3-(trifluoromethyl)pyrazole-5-carbaldehyde |
| InChIKey | CADUHCIARDLTEA-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C(F)(F)F)C=O |
Computed by PubChem (NCBI)