cas: 32896-91-6 — see every product listed under this CAS number, including other names
1-Methyl-3-nitropyridin-2(1H)-one, 98% (CAS 32896-91-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F909212-250MG |
| cas | 32896-91-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 471.73 Pln | |
| Fluorochem | 1g | 945.52 Pln | |
| Fluorochem | 5g | 3293.65 Pln | |
| Fluorochem | 10g | 5667.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-methyl-3-nitropyridin-2-one (CAS 32896-91-6) is a chemical compound with the molecular formula C6H6N2O3 and a molecular weight of 154.12 g/mol. IUPAC name: 1-methyl-3-nitropyridin-2-one. InChIKey: BDQAZNBCEXTXIW-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O3 |
|---|---|
| Molecular weight | 154.12 g/mol |
| IUPAC name | 1-methyl-3-nitropyridin-2-one |
| InChIKey | BDQAZNBCEXTXIW-UHFFFAOYSA-N |
| SMILES | CN1C=CC=C(C1=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)