1-Methyl-3-pentyl-1H-imidazol-3-ium hexafluorophosphate(V), 95%
cas: 280779-52-4 — see every product listed under this CAS number, including other names
1-Methyl-3-pentyl-1H-imidazol-3-ium hexafluorophosphate(V), 95% (CAS 280779-52-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1497711-1g |
| cas | 280779-52-4 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 136.75 Pln | |
| Ambeed | 25g | 242.44 Pln | |
| Ambeed | 100g | 637.38 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 102.80 Pln | |
| Chemat | 25g | 208.40 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 136.64 Pln | |
| BLDpharm | 25g | 253.27 Pln | |
| BLDpharm | 100g | 658.68 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
1-methyl-3-pentylimidazol-1-ium hexafluorophosphate (CAS 280779-52-4) is a chemical compound with the molecular formula C9H17F6N2P and a molecular weight of 298.21 g/mol. IUPAC name: 1-methyl-3-pentylimidazol-1-ium hexafluorophosphate. InChIKey: FONXQLHVCRQLQO-UHFFFAOYSA-N.
| Molecular formula | C9H17F6N2P |
|---|---|
| Molecular weight | 298.21 g/mol |
| IUPAC name | 1-methyl-3-pentylimidazol-1-ium hexafluorophosphate |
| InChIKey | FONXQLHVCRQLQO-UHFFFAOYSA-N |
| SMILES | CCCCCN1C=C[N+](=C1)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)
Synonyms:
1-Methyl-3-pentylimidazolium hexafluorophosphat, 1-Methyl-3-pentyl-1H-imidazol-3-ium hexafluorophosphate(V), 1-methyl-3-pentylimidazolium hexafluorophosphate, 1-methyl-3-pentylimidazol-1-ium;hexafluorophosphate, 1-methyl-3-pentyl-imidazol-1-ium;hexafluorophosphate, 1-Methyl-3-pentylimidazolium hexafluorophosphate, 99%, 3-Methyl-1-pentyl-1H-imidazol-3-ium hexafluorophosphate(V)