cas: 1033743-79-1 — see every product listed under this CAS number, including other names
1-Methyl-4-((3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)sulfonyl)piperazine 95% (CAS 1033743-79-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A457467-100mg |
| cas | 1033743-79-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 298.06 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 854.31 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A457467 |
1-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperazine (CAS 1033743-79-1) is a chemical compound with the molecular formula C17H27BN2O4S and a molecular weight of 366.3 g/mol. IUPAC name: 1-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperazine. InChIKey: IGCKYMGZVGIVIF-UHFFFAOYSA-N.
| Molecular formula | C17H27BN2O4S |
|---|---|
| Molecular weight | 366.3 g/mol |
| IUPAC name | 1-methyl-4-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]sulfonylpiperazine |
| InChIKey | IGCKYMGZVGIVIF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)S(=O)(=O)N3CCN(CC3)C |
Computed by PubChem (NCBI)